C16H24N6O3S — CID 97455536
1-[3-(dimethylsulfamoylamino)phenyl]-3-[(2R)-1-imidazol-1-ylbutan-2-yl]urea (PubChem CID 97455536) has the molecular formula C16H24N6O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoylamino)phenyl]-3-[(2R)-1-imidazol-1-ylbutan-2-yl]urea.
| Compound Name | 1-[3-(dimethylsulfamoylamino)phenyl]-3-[(2R)-1-imidazol-1-ylbutan-2-yl]urea |
|---|---|
| PubChem CID | 97455536 |
| Molecular Formula | C16H24N6O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1-[3-(dimethylsulfamoylamino)phenyl]-3-[(2R)-1-imidazol-1-ylbutan-2-yl]urea |
| SMILES | CC[C@H](Cn1ccnc1)NC(=O)Nc1cccc(NS(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C16H24N6O3S/c1-4-13(11-22-9-8-17-12-22)18-16(23)19-14-6-5-7-15(10-14)20-26(24,25)21(2)3/h5-10,12-13,20H,4,11H2,1-3H3,(H2,18,19,23)/t13-/m1/s1 |
| InChIKey | VCKLVQCUPCEVDJ-CYBMUJFWSA-N |
| XLogP | 1.70 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |