C18H20N2O3 — CID 97284758
methyl 2-[(3R)-1-(naphthalen-1-ylcarbamoyl)pyrrolidin-3-yl]acetate (PubChem CID 97284758) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is methyl 2-[(3R)-1-(naphthalen-1-ylcarbamoyl)pyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[(3R)-1-(naphthalen-1-ylcarbamoyl)pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 97284758 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | methyl 2-[(3R)-1-(naphthalen-1-ylcarbamoyl)pyrrolidin-3-yl]acetate |
| SMILES | COC(=O)C[C@H]1CCN(C(=O)Nc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C18H20N2O3/c1-23-17(21)11-13-9-10-20(12-13)18(22)19-16-8-4-6-14-5-2-3-7-15(14)16/h2-8,13H,9-12H2,1H3,(H,19,22)/t13-/m1/s1 |
| InChIKey | WYOSEYDRKSFKNN-CYBMUJFWSA-N |
| XLogP | 3.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |