C15H22N2O4 — CID 97284865
1-[(2S)-2,3-dihydroxypropyl]-1-methyl-3-[2-(2-methylprop-2-enoxy)phenyl]urea (PubChem CID 97284865) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-[(2S)-2,3-dihydroxypropyl]-1-methyl-3-[2-(2-methylprop-2-enoxy)phenyl]urea.
| Compound Name | 1-[(2S)-2,3-dihydroxypropyl]-1-methyl-3-[2-(2-methylprop-2-enoxy)phenyl]urea |
|---|---|
| PubChem CID | 97284865 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-[(2S)-2,3-dihydroxypropyl]-1-methyl-3-[2-(2-methylprop-2-enoxy)phenyl]urea |
| SMILES | C=C(C)COc1ccccc1NC(=O)N(C)C[C@H](O)CO |
| InChI | InChI=1S/C15H22N2O4/c1-11(2)10-21-14-7-5-4-6-13(14)16-15(20)17(3)8-12(19)9-18/h4-7,12,18-19H,1,8-10H2,2-3H3,(H,16,20)/t12-/m0/s1 |
| InChIKey | ZQHBYWWRCQMLMA-LBPRGKRZSA-N |
| XLogP | 1.46 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|