C21H22N4O2S — CID 97286304
(3R)-N-[3-(1,3-benzothiazol-2-yl)propyl]-5-oxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 97286304) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is (3R)-N-[3-(1,3-benzothiazol-2-yl)propyl]-5-oxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[3-(1,3-benzothiazol-2-yl)propyl]-5-oxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97286304 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (3R)-N-[3-(1,3-benzothiazol-2-yl)propyl]-5-oxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCc1nc2ccccc2s1)[C@@H]1CC(=O)N(Cc2ccncc2)C1 |
| InChI | InChI=1S/C21H22N4O2S/c26-20-12-16(14-25(20)13-15-7-10-22-11-8-15)21(27)23-9-3-6-19-24-17-4-1-2-5-18(17)28-19/h1-2,4-5,7-8,10-11,16H,3,6,9,12-14H2,(H,23,27)/t16-/m1/s1 |
| InChIKey | WFWKRZREIVVHNT-MRXNPFEDSA-N |
| XLogP | 2.79 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|