C18H21N5O2 — CID 97287337
N-[[3-[(S)-amino-(3-methoxyphenyl)methyl]-1H-1,2,4-triazol-5-yl]methyl]-4-methoxyaniline (PubChem CID 97287337) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[[3-[(S)-amino-(3-methoxyphenyl)methyl]-1H-1,2,4-triazol-5-yl]methyl]-4-methoxyaniline.
| Compound Name | N-[[3-[(S)-amino-(3-methoxyphenyl)methyl]-1H-1,2,4-triazol-5-yl]methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 97287337 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[[3-[(S)-amino-(3-methoxyphenyl)methyl]-1H-1,2,4-triazol-5-yl]methyl]-4-methoxyaniline |
| SMILES | COc1ccc(NCc2nc([C@@H](N)c3cccc(OC)c3)n[nH]2)cc1 |
| InChI | InChI=1S/C18H21N5O2/c1-24-14-8-6-13(7-9-14)20-11-16-21-18(23-22-16)17(19)12-4-3-5-15(10-12)25-2/h3-10,17,20H,11,19H2,1-2H3,(H,21,22,23)/t17-/m0/s1 |
| InChIKey | IITDDIGKFXKCNU-KRWDZBQOSA-N |
| XLogP | 2.48 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|