C13H11BrN2O2 — CID 97290155
(3R)-1-(4-bromophenyl)-3-(prop-2-ynylamino)pyrrolidine-2,5-dione (PubChem CID 97290155) has the molecular formula C13H11BrN2O2 and a molecular weight of 307.15 g/mol. Its IUPAC name is (3R)-1-(4-bromophenyl)-3-(prop-2-ynylamino)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-bromophenyl)-3-(prop-2-ynylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 97290155 |
| Molecular Formula | C13H11BrN2O2 |
| Molecular Weight | 307.15 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | (3R)-1-(4-bromophenyl)-3-(prop-2-ynylamino)pyrrolidine-2,5-dione |
| SMILES | C#CCN[C@@H]1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C13H11BrN2O2/c1-2-7-15-11-8-12(17)16(13(11)18)10-5-3-9(14)4-6-10/h1,3-6,11,15H,7-8H2/t11-/m1/s1 |
| InChIKey | QKRHYZYBAVDFHS-LLVKDONJSA-N |
| XLogP | 1.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.15 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|