C13H17FN4S — CID 97295484
methyl N-(dimethylaminomethylidene)-N'-[(Z)-1-(4-fluorophenyl)ethylideneamino]carbamimidothioate (PubChem CID 97295484) has the molecular formula C13H17FN4S and a molecular weight of 280.37 g/mol. Its IUPAC name is methyl N-(dimethylaminomethylidene)-N'-[(Z)-1-(4-fluorophenyl)ethylideneamino]carbamimidothioate.
| Compound Name | methyl N-(dimethylaminomethylidene)-N'-[(Z)-1-(4-fluorophenyl)ethylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 97295484 |
| Molecular Formula | C13H17FN4S |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | methyl N-(dimethylaminomethylidene)-N'-[(Z)-1-(4-fluorophenyl)ethylideneamino]carbamimidothioate |
| SMILES | CS/C(N=CN(C)C)=N\N=C(\C)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FN4S/c1-10(11-5-7-12(14)8-6-11)16-17-13(19-4)15-9-18(2)3/h5-9H,1-4H3/b15-9?,16-10-,17-13- |
| InChIKey | GDVNIPHACADQSW-YKXVGYDCSA-N |
| XLogP | 2.86 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|