About methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate
methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate (PubChem CID 22301907) has the molecular formula C10H12FN3S
and a molecular weight of 225.29 g/mol. Its IUPAC name is methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate.
Molecular Properties
| Compound Name | methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate |
| PubChem CID | 22301907 |
| Molecular Formula | C10H12FN3S |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate |
| SMILES | CSC(=N\N)/N=C(\C)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H12FN3S/c1-7(13-10(14-12)15-2)8-3-5-9(11)6-4-8/h3-6H,12H2,1-2H3/b13-7+,14-10- |
| InChIKey | BPFIJUUJLKFRRC-SAYYJYSRSA-N |
| XLogP | 2.23 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate?
The IUPAC name of methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate (CID 22301907) is methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate.
What is the SMILES notation for methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate?
The canonical SMILES for methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate is CSC(=N\N)/N=C(\C)c1ccc(F)cc1.
What is the InChIKey of methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate?
The InChIKey is BPFIJUUJLKFRRC-SAYYJYSRSA-N. The full InChI is InChI=1S/C10H12FN3S/c1-7(13-10(14-12)15-2)8-3-5-9(11)6-4-8/h3-6H,12H2,1-2H3/b13-7+,14-10-.
What are the key properties of methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate?
methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate has a molecular weight of 225.29 g/mol, XLogP of 2.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (NE)-N'-amino-N-[1-(4-fluorophenyl)ethylidene]carbamimidothioate is sourced from PubChem (CID 22301907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).