C5H8F5NO — CID 97302135
(2S)-1-(1,1,2,2,2-pentafluoroethoxy)propan-2-amine (PubChem CID 97302135) has the molecular formula C5H8F5NO and a molecular weight of 193.12 g/mol. Its IUPAC name is (2S)-1-(1,1,2,2,2-pentafluoroethoxy)propan-2-amine.
| Compound Name | (2S)-1-(1,1,2,2,2-pentafluoroethoxy)propan-2-amine |
|---|---|
| PubChem CID | 97302135 |
| Molecular Formula | C5H8F5NO |
| Molecular Weight | 193.12 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | (2S)-1-(1,1,2,2,2-pentafluoroethoxy)propan-2-amine |
| SMILES | C[C@H](N)COC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H8F5NO/c1-3(11)2-12-5(9,10)4(6,7)8/h3H,2,11H2,1H3/t3-/m0/s1 |
| InChIKey | YJKODVJQMYPFTQ-VKHMYHEASA-N |
| XLogP | 1.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.12 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|