C19H13ClN2O4S — CID 97304531
(Z)-1-(4-chlorophenyl)-3-[2-[(E)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]thiophen-3-yl]prop-2-en-1-one (PubChem CID 97304531) has the molecular formula C19H13ClN2O4S and a molecular weight of 400.84 g/mol. Its IUPAC name is (Z)-1-(4-chlorophenyl)-3-[2-[(E)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]thiophen-3-yl]prop-2-en-1-one.
| Compound Name | (Z)-1-(4-chlorophenyl)-3-[2-[(E)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]thiophen-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 97304531 |
| Molecular Formula | C19H13ClN2O4S |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | (Z)-1-(4-chlorophenyl)-3-[2-[(E)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]thiophen-3-yl]prop-2-en-1-one |
| SMILES | Cc1noc(/C=C/c2sccc2/C=C\C(=O)c2ccc(Cl)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H13ClN2O4S/c1-12-19(22(24)25)17(26-21-12)8-9-18-14(10-11-27-18)4-7-16(23)13-2-5-15(20)6-3-13/h2-11H,1H3/b7-4-,9-8+ |
| InChIKey | KVBGAGAJADBEQB-NKUJDFQBSA-N |
| XLogP | 5.67 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|