C19H24N2O2S — CID 97306180
[(3S,4S)-3-methylsulfanyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-(4-prop-2-ynoxyphenyl)methanone (PubChem CID 97306180) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is [(3S,4S)-3-methylsulfanyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-(4-prop-2-ynoxyphenyl)methanone.
| Compound Name | [(3S,4S)-3-methylsulfanyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-(4-prop-2-ynoxyphenyl)methanone |
|---|---|
| PubChem CID | 97306180 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [(3S,4S)-3-methylsulfanyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-(4-prop-2-ynoxyphenyl)methanone |
| SMILES | C#CCOc1ccc(C(=O)N2C[C@H](SC)[C@@H](N3CCCC3)C2)cc1 |
| InChI | InChI=1S/C19H24N2O2S/c1-3-12-23-16-8-6-15(7-9-16)19(22)21-13-17(18(14-21)24-2)20-10-4-5-11-20/h1,6-9,17-18H,4-5,10-14H2,2H3/t17-,18-/m0/s1 |
| InChIKey | WYKJHIPRPQLKRP-ROUUACIJSA-N |
| XLogP | 2.35 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|