C13H20N2O4 — CID 97307698
ethyl (2R)-3-[(1-cyanocyclopentanecarbonyl)amino]-2-hydroxy-2-methylpropanoate (PubChem CID 97307698) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is ethyl (2R)-3-[(1-cyanocyclopentanecarbonyl)amino]-2-hydroxy-2-methylpropanoate.
| Compound Name | ethyl (2R)-3-[(1-cyanocyclopentanecarbonyl)amino]-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 97307698 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | ethyl (2R)-3-[(1-cyanocyclopentanecarbonyl)amino]-2-hydroxy-2-methylpropanoate |
| SMILES | CCOC(=O)[C@](C)(O)CNC(=O)C1(C#N)CCCC1 |
| InChI | InChI=1S/C13H20N2O4/c1-3-19-11(17)12(2,18)9-15-10(16)13(8-14)6-4-5-7-13/h18H,3-7,9H2,1-2H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | NQVCDKIZOGXQLN-GFCCVEGCSA-N |
| XLogP | 0.50 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |