C14H14N4OS2 — CID 973077
5-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-amine (PubChem CID 973077) has the molecular formula C14H14N4OS2 and a molecular weight of 318.43 g/mol. Its IUPAC name is 5-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | 5-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 973077 |
| Molecular Formula | C14H14N4OS2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 5-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-amine |
| SMILES | COc1cccc(Nc2nc(-c3sc(N)nc3C)cs2)c1 |
| InChI | InChI=1S/C14H14N4OS2/c1-8-12(21-13(15)16-8)11-7-20-14(18-11)17-9-4-3-5-10(6-9)19-2/h3-7H,1-2H3,(H2,15,16)(H,17,18) |
| InChIKey | RKQANLPLHCTTLJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazole_amine_A(4)', 'substructure': 'N/A'} |
|---|