About [(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate
[(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate (PubChem CID 97308909) has the molecular formula C17H20N2O3
and a molecular weight of 300.36 g/mol. Its IUPAC name is [(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate.
Molecular Properties
| Compound Name | [(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate |
| PubChem CID | 97308909 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | [(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate |
| SMILES | C[C@@H](OC(=O)CN1CCOCC1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C17H20N2O3/c1-13(22-17(20)12-19-6-8-21-9-7-19)15-10-14-4-2-3-5-16(14)18-11-15/h2-5,10-11,13H,6-9,12H2,1H3/t13-/m1/s1 |
| InChIKey | VOOQGHFEENWWPD-CYBMUJFWSA-N |
| XLogP | 2.17 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate?
The IUPAC name of [(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate (CID 97308909) is [(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate.
What is the SMILES notation for [(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate?
The canonical SMILES for [(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate is C[C@@H](OC(=O)CN1CCOCC1)c1cnc2ccccc2c1.
What is the InChIKey of [(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate?
The InChIKey is VOOQGHFEENWWPD-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H20N2O3/c1-13(22-17(20)12-19-6-8-21-9-7-19)15-10-14-4-2-3-5-16(14)18-11-15/h2-5,10-11,13H,6-9,12H2,1H3/t13-/m1/s1.
What are the key properties of [(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate?
[(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate has a molecular weight of 300.36 g/mol, XLogP of 2.17, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-quinolin-3-ylethyl] 2-morpholin-4-ylacetate is sourced from PubChem (CID 97308909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).