About ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline
ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline (PubChem CID 144672384) has the molecular formula C21H35N3O
and a molecular weight of 345.53 g/mol. Its IUPAC name is ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline.
Molecular Properties
| Compound Name | ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline |
| PubChem CID | 144672384 |
| Molecular Formula | C21H35N3O |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline |
| SMILES | CC.CC(C)c1cnc2ccccc2c1.CNCCN1CCOCC1 |
| InChI | InChI=1S/C12H13N.C7H16N2O.C2H6/c1-9(2)11-7-10-5-3-4-6-12(10)13-8-11;1-8-2-3-9-4-6-10-7-5-9;1-2/h3-9H,1-2H3;8H,2-7H2,1H3;1-2H3 |
| InChIKey | ROYMXPYHYWJROT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline?
The IUPAC name of ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline (CID 144672384) is ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline.
What is the SMILES notation for ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline?
The canonical SMILES for ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline is CC.CC(C)c1cnc2ccccc2c1.CNCCN1CCOCC1.
What is the InChIKey of ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline?
The InChIKey is ROYMXPYHYWJROT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N.C7H16N2O.C2H6/c1-9(2)11-7-10-5-3-4-6-12(10)13-8-11;1-8-2-3-9-4-6-10-7-5-9;1-2/h3-9H,1-2H3;8H,2-7H2,1H3;1-2H3.
What are the key properties of ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline?
ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline has a molecular weight of 345.53 g/mol, XLogP of 3.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-2-morpholin-4-ylethanamine;3-propan-2-ylquinoline is sourced from PubChem (CID 144672384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).