C15H11F2N3O4 — CID 97309297
N-[(1S)-2-amino-1-(4-fluorophenyl)-2-oxoethyl]-4-fluoro-2-nitrobenzamide (PubChem CID 97309297) has the molecular formula C15H11F2N3O4 and a molecular weight of 335.27 g/mol. Its IUPAC name is N-[(1S)-2-amino-1-(4-fluorophenyl)-2-oxoethyl]-4-fluoro-2-nitrobenzamide.
| Compound Name | N-[(1S)-2-amino-1-(4-fluorophenyl)-2-oxoethyl]-4-fluoro-2-nitrobenzamide |
|---|---|
| PubChem CID | 97309297 |
| Molecular Formula | C15H11F2N3O4 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-[(1S)-2-amino-1-(4-fluorophenyl)-2-oxoethyl]-4-fluoro-2-nitrobenzamide |
| SMILES | NC(=O)[C@@H](NC(=O)c1ccc(F)cc1[N+](=O)[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C15H11F2N3O4/c16-9-3-1-8(2-4-9)13(14(18)21)19-15(22)11-6-5-10(17)7-12(11)20(23)24/h1-7,13H,(H2,18,21)(H,19,22)/t13-/m0/s1 |
| InChIKey | PEWWRNFZYLLAAS-ZDUSSCGKSA-N |
| XLogP | 1.83 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|