C21H32ClN3O3 — CID 97309862
tert-butyl (2S)-2-[(2R)-2-[2-[(2-chlorobenzoyl)amino]ethylamino]propyl]pyrrolidine-1-carboxylate (PubChem CID 97309862) has the molecular formula C21H32ClN3O3 and a molecular weight of 409.96 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2R)-2-[2-[(2-chlorobenzoyl)amino]ethylamino]propyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2R)-2-[2-[(2-chlorobenzoyl)amino]ethylamino]propyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97309862 |
| Molecular Formula | C21H32ClN3O3 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | tert-butyl (2S)-2-[(2R)-2-[2-[(2-chlorobenzoyl)amino]ethylamino]propyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@H](C[C@@H]1CCCN1C(=O)OC(C)(C)C)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H32ClN3O3/c1-15(14-16-8-7-13-25(16)20(27)28-21(2,3)4)23-11-12-24-19(26)17-9-5-6-10-18(17)22/h5-6,9-10,15-16,23H,7-8,11-14H2,1-4H3,(H,24,26)/t15-,16+/m1/s1 |
| InChIKey | LRLNJGQVVROVCN-CVEARBPZSA-N |
| XLogP | 3.84 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|