C17H14F2N2O — CID 97310245
1-[(3S)-3,5-bis(3-fluorophenyl)-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 97310245) has the molecular formula C17H14F2N2O and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-[(3S)-3,5-bis(3-fluorophenyl)-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 1-[(3S)-3,5-bis(3-fluorophenyl)-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 97310245 |
| Molecular Formula | C17H14F2N2O |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-[(3S)-3,5-bis(3-fluorophenyl)-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2cccc(F)c2)C[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C17H14F2N2O/c1-11(22)21-17(13-5-3-7-15(19)9-13)10-16(20-21)12-4-2-6-14(18)8-12/h2-9,17H,10H2,1H3/t17-/m0/s1 |
| InChIKey | LSDPRLRNTMEJME-KRWDZBQOSA-N |
| XLogP | 3.66 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |