C29H27FN2O5 — CID 25158117
methyl (E)-2-[2-[[3-[2-acetyl-3-(3-fluorophenyl)-3,4-dihydropyrazol-5-yl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 25158117) has the molecular formula C29H27FN2O5 and a molecular weight of 502.54 g/mol. Its IUPAC name is methyl (E)-2-[2-[[3-[2-acetyl-3-(3-fluorophenyl)-3,4-dihydropyrazol-5-yl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[3-[2-acetyl-3-(3-fluorophenyl)-3,4-dihydropyrazol-5-yl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 25158117 |
| Molecular Formula | C29H27FN2O5 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | methyl (E)-2-[2-[[3-[2-acetyl-3-(3-fluorophenyl)-3,4-dihydropyrazol-5-yl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1cccc(C2=NN(C(C)=O)C(c3cccc(F)c3)C2)c1 |
| InChI | InChI=1S/C29H27FN2O5/c1-19(33)32-28(21-10-6-11-23(30)14-21)16-27(31-32)20-9-7-12-24(15-20)37-17-22-8-4-5-13-25(22)26(18-35-2)29(34)36-3/h4-15,18,28H,16-17H2,1-3H3/b26-18+ |
| InChIKey | LDNWTMMGMSLAHP-NLRVBDNBSA-N |
| XLogP | 5.26 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|