C28H28N2O4 — CID 139758714
methyl 3-methoxy-2-[2-[[3-(2-methyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenoxy]methyl]phenyl]prop-2-enoate (PubChem CID 139758714) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is methyl 3-methoxy-2-[2-[[3-(2-methyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenoxy]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-methoxy-2-[2-[[3-(2-methyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenoxy]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 139758714 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | methyl 3-methoxy-2-[2-[[3-(2-methyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenoxy]methyl]phenyl]prop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1COc1cccc(C2=NN(C)C(c3ccccc3)C2)c1 |
| InChI | InChI=1S/C28H28N2O4/c1-30-27(20-10-5-4-6-11-20)17-26(29-30)21-13-9-14-23(16-21)34-18-22-12-7-8-15-24(22)25(19-32-2)28(31)33-3/h4-16,19,27H,17-18H2,1-3H3 |
| InChIKey | OHQDRBJAMUNPLG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|