C33H36N2O5 — CID 25156649
methyl (E)-2-[2-[[3-[2-acetyl-3-(4-tert-butylphenyl)-3,4-dihydropyrazol-5-yl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 25156649) has the molecular formula C33H36N2O5 and a molecular weight of 540.66 g/mol. Its IUPAC name is methyl (E)-2-[2-[[3-[2-acetyl-3-(4-tert-butylphenyl)-3,4-dihydropyrazol-5-yl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[3-[2-acetyl-3-(4-tert-butylphenyl)-3,4-dihydropyrazol-5-yl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 25156649 |
| Molecular Formula | C33H36N2O5 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | methyl (E)-2-[2-[[3-[2-acetyl-3-(4-tert-butylphenyl)-3,4-dihydropyrazol-5-yl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1cccc(C2=NN(C(C)=O)C(c3ccc(C(C)(C)C)cc3)C2)c1 |
| InChI | InChI=1S/C33H36N2O5/c1-22(36)35-31(23-14-16-26(17-15-23)33(2,3)4)19-30(34-35)24-11-9-12-27(18-24)40-20-25-10-7-8-13-28(25)29(21-38-5)32(37)39-6/h7-18,21,31H,19-20H2,1-6H3/b29-21+ |
| InChIKey | POIBDXQSIXIAFA-XHLNEMQHSA-N |
| XLogP | 6.42 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|