C18H17F3N4O4 — CID 97310700
[(2R)-3-cyano-1,1,1-trifluoro-2-(1-methylimidazol-2-yl)propan-2-yl] 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate (PubChem CID 97310700) has the molecular formula C18H17F3N4O4 and a molecular weight of 410.35 g/mol. Its IUPAC name is [(2R)-3-cyano-1,1,1-trifluoro-2-(1-methylimidazol-2-yl)propan-2-yl] 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate.
| Compound Name | [(2R)-3-cyano-1,1,1-trifluoro-2-(1-methylimidazol-2-yl)propan-2-yl] 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 97310700 |
| Molecular Formula | C18H17F3N4O4 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [(2R)-3-cyano-1,1,1-trifluoro-2-(1-methylimidazol-2-yl)propan-2-yl] 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
| SMILES | Cn1ccnc1[C@@](CC#N)(OC(=O)CN1C(=O)[C@H]2CC=CC[C@H]2C1=O)C(F)(F)F |
| InChI | InChI=1S/C18H17F3N4O4/c1-24-9-8-23-16(24)17(6-7-22,18(19,20)21)29-13(26)10-25-14(27)11-4-2-3-5-12(11)15(25)28/h2-3,8-9,11-12H,4-6,10H2,1H3/t11-,12+,17-/m1/s1 |
| InChIKey | CKCLFEYGALWQNE-BWACUDIHSA-N |
| XLogP | 1.59 |
| TPSA | 105.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|