C15H18N2O3 — CID 97311380
prop-2-ynyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridine-3-carboxylate (PubChem CID 97311380) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is prop-2-ynyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridine-3-carboxylate.
| Compound Name | prop-2-ynyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 97311380 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | prop-2-ynyl 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]pyridine-3-carboxylate |
| SMILES | C#CCOC(=O)c1ccc(N2C[C@H](C)O[C@@H](C)C2)nc1 |
| InChI | InChI=1S/C15H18N2O3/c1-4-7-19-15(18)13-5-6-14(16-8-13)17-9-11(2)20-12(3)10-17/h1,5-6,8,11-12H,7,9-10H2,2-3H3/t11-,12-/m0/s1 |
| InChIKey | QXWFYYJGLBZLKV-RYUDHWBXSA-N |
| XLogP | 1.49 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|