C21H22FNO2 — CID 97312314
(3R,3aS,8aR)-1-benzyl-3-(3-fluorophenyl)-3,3a,5,6,8,8a-hexahydro-2H-oxepino[3,4-b]pyrrol-4-one (PubChem CID 97312314) has the molecular formula C21H22FNO2 and a molecular weight of 339.41 g/mol. Its IUPAC name is (3R,3aS,8aR)-1-benzyl-3-(3-fluorophenyl)-3,3a,5,6,8,8a-hexahydro-2H-oxepino[3,4-b]pyrrol-4-one.
| Compound Name | (3R,3aS,8aR)-1-benzyl-3-(3-fluorophenyl)-3,3a,5,6,8,8a-hexahydro-2H-oxepino[3,4-b]pyrrol-4-one |
|---|---|
| PubChem CID | 97312314 |
| Molecular Formula | C21H22FNO2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (3R,3aS,8aR)-1-benzyl-3-(3-fluorophenyl)-3,3a,5,6,8,8a-hexahydro-2H-oxepino[3,4-b]pyrrol-4-one |
| SMILES | O=C1CCOC[C@H]2[C@@H]1[C@H](c1cccc(F)c1)CN2Cc1ccccc1 |
| InChI | InChI=1S/C21H22FNO2/c22-17-8-4-7-16(11-17)18-13-23(12-15-5-2-1-3-6-15)19-14-25-10-9-20(24)21(18)19/h1-8,11,18-19,21H,9-10,12-14H2/t18-,19-,21-/m0/s1 |
| InChIKey | IBYGCEXYWLDSTD-ZJOUEHCJSA-N |
| XLogP | 3.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |