C17H24N4OS — CID 97317498
1-[3-(2-methylimidazol-1-yl)propyl]-3-[(1S)-2-methylsulfanyl-1-phenylethyl]urea (PubChem CID 97317498) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-[3-(2-methylimidazol-1-yl)propyl]-3-[(1S)-2-methylsulfanyl-1-phenylethyl]urea.
| Compound Name | 1-[3-(2-methylimidazol-1-yl)propyl]-3-[(1S)-2-methylsulfanyl-1-phenylethyl]urea |
|---|---|
| PubChem CID | 97317498 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-[3-(2-methylimidazol-1-yl)propyl]-3-[(1S)-2-methylsulfanyl-1-phenylethyl]urea |
| SMILES | CSC[C@@H](NC(=O)NCCCn1ccnc1C)c1ccccc1 |
| InChI | InChI=1S/C17H24N4OS/c1-14-18-10-12-21(14)11-6-9-19-17(22)20-16(13-23-2)15-7-4-3-5-8-15/h3-5,7-8,10,12,16H,6,9,11,13H2,1-2H3,(H2,19,20,22)/t16-/m1/s1 |
| InChIKey | SOAGXXJGUZOULN-MRXNPFEDSA-N |
| XLogP | 2.99 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|