C16H19FN4OS — CID 97318687
(3S)-N-(3-fluoro-4-methylsulfanylphenyl)-3-(1H-imidazol-2-yl)piperidine-1-carboxamide (PubChem CID 97318687) has the molecular formula C16H19FN4OS and a molecular weight of 334.42 g/mol. Its IUPAC name is (3S)-N-(3-fluoro-4-methylsulfanylphenyl)-3-(1H-imidazol-2-yl)piperidine-1-carboxamide.
| Compound Name | (3S)-N-(3-fluoro-4-methylsulfanylphenyl)-3-(1H-imidazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97318687 |
| Molecular Formula | C16H19FN4OS |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (3S)-N-(3-fluoro-4-methylsulfanylphenyl)-3-(1H-imidazol-2-yl)piperidine-1-carboxamide |
| SMILES | CSc1ccc(NC(=O)N2CCC[C@H](c3ncc[nH]3)C2)cc1F |
| InChI | InChI=1S/C16H19FN4OS/c1-23-14-5-4-12(9-13(14)17)20-16(22)21-8-2-3-11(10-21)15-18-6-7-19-15/h4-7,9,11H,2-3,8,10H2,1H3,(H,18,19)(H,20,22)/t11-/m0/s1 |
| InChIKey | DIGVRRMFDCDYBT-NSHDSACASA-N |
| XLogP | 3.68 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |