C18H24N4OS — CID 95968867
(3S)-3-(1H-imidazol-2-yl)-N-[(2R)-2-phenylsulfanylpropyl]piperidine-1-carboxamide (PubChem CID 95968867) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is (3S)-3-(1H-imidazol-2-yl)-N-[(2R)-2-phenylsulfanylpropyl]piperidine-1-carboxamide.
| Compound Name | (3S)-3-(1H-imidazol-2-yl)-N-[(2R)-2-phenylsulfanylpropyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95968867 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (3S)-3-(1H-imidazol-2-yl)-N-[(2R)-2-phenylsulfanylpropyl]piperidine-1-carboxamide |
| SMILES | C[C@H](CNC(=O)N1CCC[C@H](c2ncc[nH]2)C1)Sc1ccccc1 |
| InChI | InChI=1S/C18H24N4OS/c1-14(24-16-7-3-2-4-8-16)12-21-18(23)22-11-5-6-15(13-22)17-19-9-10-20-17/h2-4,7-10,14-15H,5-6,11-13H2,1H3,(H,19,20)(H,21,23)/t14-,15+/m1/s1 |
| InChIKey | NXSYEPZNOCVJAH-CABCVRRESA-N |
| XLogP | 3.48 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |