C19H26N4O — CID 126437006
(3R)-3-(1H-imidazol-2-yl)-N-[3-(4-methylphenyl)propyl]piperidine-1-carboxamide (PubChem CID 126437006) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is (3R)-3-(1H-imidazol-2-yl)-N-[3-(4-methylphenyl)propyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-(1H-imidazol-2-yl)-N-[3-(4-methylphenyl)propyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126437006 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (3R)-3-(1H-imidazol-2-yl)-N-[3-(4-methylphenyl)propyl]piperidine-1-carboxamide |
| SMILES | Cc1ccc(CCCNC(=O)N2CCC[C@@H](c3ncc[nH]3)C2)cc1 |
| InChI | InChI=1S/C19H26N4O/c1-15-6-8-16(9-7-15)4-2-10-22-19(24)23-13-3-5-17(14-23)18-20-11-12-21-18/h6-9,11-12,17H,2-5,10,13-14H2,1H3,(H,20,21)(H,22,24)/t17-/m1/s1 |
| InChIKey | RSODCTBFMODVMS-QGZVFWFLSA-N |
| XLogP | 3.24 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|