C13H20N8OS — CID 126451352
(3R)-3-(1H-imidazol-2-yl)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]piperidine-1-carboxamide (PubChem CID 126451352) has the molecular formula C13H20N8OS and a molecular weight of 336.43 g/mol. Its IUPAC name is (3R)-3-(1H-imidazol-2-yl)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-(1H-imidazol-2-yl)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126451352 |
| Molecular Formula | C13H20N8OS |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (3R)-3-(1H-imidazol-2-yl)-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]piperidine-1-carboxamide |
| SMILES | Cn1nnnc1SCCNC(=O)N1CCC[C@@H](c2ncc[nH]2)C1 |
| InChI | InChI=1S/C13H20N8OS/c1-20-13(17-18-19-20)23-8-6-16-12(22)21-7-2-3-10(9-21)11-14-4-5-15-11/h4-5,10H,2-3,6-9H2,1H3,(H,14,15)(H,16,22)/t10-/m1/s1 |
| InChIKey | XYIQXSVBGRZRCZ-SNVBAGLBSA-N |
| XLogP | 0.61 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|