C12H15N7O2S — CID 70752444
2-cyclopropyl-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 70752444) has the molecular formula C12H15N7O2S and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-cyclopropyl-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-cyclopropyl-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 70752444 |
| Molecular Formula | C12H15N7O2S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-cyclopropyl-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cn1nnnc1SCCNC(=O)c1cnc(C2CC2)[nH]c1=O |
| InChI | InChI=1S/C12H15N7O2S/c1-19-12(16-17-18-19)22-5-4-13-10(20)8-6-14-9(7-2-3-7)15-11(8)21/h6-7H,2-5H2,1H3,(H,13,20)(H,14,15,21) |
| InChIKey | VXMBBOVCXPUZRS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|