C10H18N6O2S — CID 155496366
(1S,3S,4S)-3-amino-4-hydroxy-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]cyclopentane-1-carboxamide (PubChem CID 155496366) has the molecular formula C10H18N6O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is (1S,3S,4S)-3-amino-4-hydroxy-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]cyclopentane-1-carboxamide.
| Compound Name | (1S,3S,4S)-3-amino-4-hydroxy-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 155496366 |
| Molecular Formula | C10H18N6O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (1S,3S,4S)-3-amino-4-hydroxy-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]cyclopentane-1-carboxamide |
| SMILES | Cn1nnnc1SCCNC(=O)[C@H]1C[C@H](N)[C@@H](O)C1 |
| InChI | InChI=1S/C10H18N6O2S/c1-16-10(13-14-15-16)19-3-2-12-9(18)6-4-7(11)8(17)5-6/h6-8,17H,2-5,11H2,1H3,(H,12,18)/t6-,7-,8-/m0/s1 |
| InChIKey | IPFXZTJMKQQVIN-FXQIFTODSA-N |
| XLogP | -1.48 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|