C18H23FN6O2S — CID 24793025
1-[2-(3-fluorophenyl)ethyl]-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-6-oxopiperidine-3-carboxamide (PubChem CID 24793025) has the molecular formula C18H23FN6O2S and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 24793025 |
| Molecular Formula | C18H23FN6O2S |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-6-oxopiperidine-3-carboxamide |
| SMILES | Cn1nnnc1SCCNC(=O)C1CCC(=O)N(CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C18H23FN6O2S/c1-24-18(21-22-23-24)28-10-8-20-17(27)14-5-6-16(26)25(12-14)9-7-13-3-2-4-15(19)11-13/h2-4,11,14H,5-10,12H2,1H3,(H,20,27) |
| InChIKey | HQJFLDFPCBUMLP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|