C17H24N4OS — CID 95967517
(3S)-3-(1H-imidazol-2-yl)-N-[(2R)-2-methyl-3-thiophen-2-ylpropyl]piperidine-1-carboxamide (PubChem CID 95967517) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is (3S)-3-(1H-imidazol-2-yl)-N-[(2R)-2-methyl-3-thiophen-2-ylpropyl]piperidine-1-carboxamide.
| Compound Name | (3S)-3-(1H-imidazol-2-yl)-N-[(2R)-2-methyl-3-thiophen-2-ylpropyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95967517 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (3S)-3-(1H-imidazol-2-yl)-N-[(2R)-2-methyl-3-thiophen-2-ylpropyl]piperidine-1-carboxamide |
| SMILES | C[C@@H](CNC(=O)N1CCC[C@H](c2ncc[nH]2)C1)Cc1cccs1 |
| InChI | InChI=1S/C17H24N4OS/c1-13(10-15-5-3-9-23-15)11-20-17(22)21-8-2-4-14(12-21)16-18-6-7-19-16/h3,5-7,9,13-14H,2,4,8,10-12H2,1H3,(H,18,19)(H,20,22)/t13-,14+/m1/s1 |
| InChIKey | HOALZYOKNQGGRY-KGLIPLIRSA-N |
| XLogP | 3.24 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |