C15H15FN4O2 — CID 97319052
(3S)-3-[(4-fluorophenyl)methyl]-1-[2-(1,2,4-triazol-1-yl)ethyl]pyrrolidine-2,5-dione (PubChem CID 97319052) has the molecular formula C15H15FN4O2 and a molecular weight of 302.31 g/mol. Its IUPAC name is (3S)-3-[(4-fluorophenyl)methyl]-1-[2-(1,2,4-triazol-1-yl)ethyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[(4-fluorophenyl)methyl]-1-[2-(1,2,4-triazol-1-yl)ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 97319052 |
| Molecular Formula | C15H15FN4O2 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (3S)-3-[(4-fluorophenyl)methyl]-1-[2-(1,2,4-triazol-1-yl)ethyl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](Cc2ccc(F)cc2)C(=O)N1CCn1cncn1 |
| InChI | InChI=1S/C15H15FN4O2/c16-13-3-1-11(2-4-13)7-12-8-14(21)20(15(12)22)6-5-19-10-17-9-18-19/h1-4,9-10,12H,5-8H2/t12-/m0/s1 |
| InChIKey | NVXRUQQJQBQYOH-LBPRGKRZSA-N |
| XLogP | 1.03 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|