C14H15FN2O3 — CID 98177833
3-[(3R)-3-[(4-fluorophenyl)methyl]-2,5-dioxopyrrolidin-1-yl]propanamide (PubChem CID 98177833) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 3-[(3R)-3-[(4-fluorophenyl)methyl]-2,5-dioxopyrrolidin-1-yl]propanamide.
| Compound Name | 3-[(3R)-3-[(4-fluorophenyl)methyl]-2,5-dioxopyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 98177833 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-[(3R)-3-[(4-fluorophenyl)methyl]-2,5-dioxopyrrolidin-1-yl]propanamide |
| SMILES | NC(=O)CCN1C(=O)C[C@@H](Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C14H15FN2O3/c15-11-3-1-9(2-4-11)7-10-8-13(19)17(14(10)20)6-5-12(16)18/h1-4,10H,5-8H2,(H2,16,18)/t10-/m1/s1 |
| InChIKey | QGZZVUHUOWJRHK-SNVBAGLBSA-N |
| XLogP | 0.62 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|