C20H21FN4 — CID 97323600
(3S)-1-(3-fluoro-2-pyridinyl)-N-[(1R)-1-quinolin-2-ylethyl]pyrrolidin-3-amine (PubChem CID 97323600) has the molecular formula C20H21FN4 and a molecular weight of 336.41 g/mol. Its IUPAC name is (3S)-1-(3-fluoro-2-pyridinyl)-N-[(1R)-1-quinolin-2-ylethyl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-(3-fluoro-2-pyridinyl)-N-[(1R)-1-quinolin-2-ylethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 97323600 |
| Molecular Formula | C20H21FN4 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (3S)-1-(3-fluoro-2-pyridinyl)-N-[(1R)-1-quinolin-2-ylethyl]pyrrolidin-3-amine |
| SMILES | C[C@@H](N[C@H]1CCN(c2ncccc2F)C1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C20H21FN4/c1-14(18-9-8-15-5-2-3-7-19(15)24-18)23-16-10-12-25(13-16)20-17(21)6-4-11-22-20/h2-9,11,14,16,23H,10,12-13H2,1H3/t14-,16+/m1/s1 |
| InChIKey | DSCVZDJDOYTSMP-ZBFHGGJFSA-N |
| XLogP | 3.70 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |