C17H22N4O3 — CID 97324930
(3S)-N-[[3-[(1R)-1-ethoxyethyl]-1,2,4-oxadiazol-5-yl]methyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 97324930) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (3S)-N-[[3-[(1R)-1-ethoxyethyl]-1,2,4-oxadiazol-5-yl]methyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3S)-N-[[3-[(1R)-1-ethoxyethyl]-1,2,4-oxadiazol-5-yl]methyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 97324930 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (3S)-N-[[3-[(1R)-1-ethoxyethyl]-1,2,4-oxadiazol-5-yl]methyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | CCO[C@H](C)c1noc(CNC(=O)[C@@H]2Cc3ccccc3CN2)n1 |
| InChI | InChI=1S/C17H22N4O3/c1-3-23-11(2)16-20-15(24-21-16)10-19-17(22)14-8-12-6-4-5-7-13(12)9-18-14/h4-7,11,14,18H,3,8-10H2,1-2H3,(H,19,22)/t11-,14+/m1/s1 |
| InChIKey | ODYXMFCNTJPVRM-RISCZKNCSA-N |
| XLogP | 1.50 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |