C24H25N5O — CID 97325931
(7R)-N-[[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide (PubChem CID 97325931) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is (7R)-N-[[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide.
| Compound Name | (7R)-N-[[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 97325931 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | (7R)-N-[[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
| SMILES | Cc1cc2nc(-c3ccc(CNC(=O)[C@@H]4CCn5cncc5C4)cc3)[nH]c2cc1C |
| InChI | InChI=1S/C24H25N5O/c1-15-9-21-22(10-16(15)2)28-23(27-21)18-5-3-17(4-6-18)12-26-24(30)19-7-8-29-14-25-13-20(29)11-19/h3-6,9-10,13-14,19H,7-8,11-12H2,1-2H3,(H,26,30)(H,27,28)/t19-/m1/s1 |
| InChIKey | IIIXPKNOJBNMHN-LJQANCHMSA-N |
| XLogP | 3.92 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |