About 3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide
3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide (PubChem CID 97326732) has the molecular formula C13H17NO2S
and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide.
Molecular Properties
| Compound Name | 3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide |
| PubChem CID | 97326732 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide |
| SMILES | C[C@H]1OCC[C@@H]1SCc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C13H17NO2S/c1-9-12(5-6-16-9)17-8-10-3-2-4-11(7-10)13(14)15/h2-4,7,9,12H,5-6,8H2,1H3,(H2,14,15)/t9-,12+/m1/s1 |
| InChIKey | CXEUOOQOBZHUMD-SKDRFNHKSA-N |
| XLogP | 2.20 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide?
The IUPAC name of 3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide (CID 97326732) is 3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide.
What is the SMILES notation for 3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide?
The canonical SMILES for 3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide is C[C@H]1OCC[C@@H]1SCc1cccc(C(N)=O)c1.
What is the InChIKey of 3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide?
The InChIKey is CXEUOOQOBZHUMD-SKDRFNHKSA-N. The full InChI is InChI=1S/C13H17NO2S/c1-9-12(5-6-16-9)17-8-10-3-2-4-11(7-10)13(14)15/h2-4,7,9,12H,5-6,8H2,1H3,(H2,14,15)/t9-,12+/m1/s1.
What are the key properties of 3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide?
3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide has a molecular weight of 251.35 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2R,3S)-2-methyloxolan-3-yl]sulfanylmethyl]benzamide is sourced from PubChem (CID 97326732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).