C18H17FN2O2S — CID 96530782
3-[[(3S)-1-(2-fluorophenyl)-2-oxopyrrolidin-3-yl]sulfanylmethyl]benzamide (PubChem CID 96530782) has the molecular formula C18H17FN2O2S and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-[[(3S)-1-(2-fluorophenyl)-2-oxopyrrolidin-3-yl]sulfanylmethyl]benzamide.
| Compound Name | 3-[[(3S)-1-(2-fluorophenyl)-2-oxopyrrolidin-3-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 96530782 |
| Molecular Formula | C18H17FN2O2S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 3-[[(3S)-1-(2-fluorophenyl)-2-oxopyrrolidin-3-yl]sulfanylmethyl]benzamide |
| SMILES | NC(=O)c1cccc(CS[C@H]2CCN(c3ccccc3F)C2=O)c1 |
| InChI | InChI=1S/C18H17FN2O2S/c19-14-6-1-2-7-15(14)21-9-8-16(18(21)23)24-11-12-4-3-5-13(10-12)17(20)22/h1-7,10,16H,8-9,11H2,(H2,20,22)/t16-/m0/s1 |
| InChIKey | APRICOZIPHZTID-INIZCTEOSA-N |
| XLogP | 2.96 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |