C14H16BrF3N2O3 — CID 97327842
1-[2-bromo-4-(trifluoromethoxy)phenyl]-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea (PubChem CID 97327842) has the molecular formula C14H16BrF3N2O3 and a molecular weight of 397.19 g/mol. Its IUPAC name is 1-[2-bromo-4-(trifluoromethoxy)phenyl]-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea.
| Compound Name | 1-[2-bromo-4-(trifluoromethoxy)phenyl]-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 97327842 |
| Molecular Formula | C14H16BrF3N2O3 |
| Molecular Weight | 397.19 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 1-[2-bromo-4-(trifluoromethoxy)phenyl]-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea |
| SMILES | C[C@H](NC(=O)Nc1ccc(OC(F)(F)F)cc1Br)[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H16BrF3N2O3/c1-8(12-3-2-6-22-12)19-13(21)20-11-5-4-9(7-10(11)15)23-14(16,17)18/h4-5,7-8,12H,2-3,6H2,1H3,(H2,19,20,21)/t8-,12-/m0/s1 |
| InChIKey | BPRJHZSGPITZSU-UFBFGSQYSA-N |
| XLogP | 4.04 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.19 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |