C17H25BrN2O3 — CID 97328285
(2R)-2-(2-bromophenoxy)-1-[4-[2-hydroxyethyl(methyl)amino]piperidin-1-yl]propan-1-one (PubChem CID 97328285) has the molecular formula C17H25BrN2O3 and a molecular weight of 385.30 g/mol. Its IUPAC name is (2R)-2-(2-bromophenoxy)-1-[4-[2-hydroxyethyl(methyl)amino]piperidin-1-yl]propan-1-one.
| Compound Name | (2R)-2-(2-bromophenoxy)-1-[4-[2-hydroxyethyl(methyl)amino]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 97328285 |
| Molecular Formula | C17H25BrN2O3 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (2R)-2-(2-bromophenoxy)-1-[4-[2-hydroxyethyl(methyl)amino]piperidin-1-yl]propan-1-one |
| SMILES | C[C@@H](Oc1ccccc1Br)C(=O)N1CCC(N(C)CCO)CC1 |
| InChI | InChI=1S/C17H25BrN2O3/c1-13(23-16-6-4-3-5-15(16)18)17(22)20-9-7-14(8-10-20)19(2)11-12-21/h3-6,13-14,21H,7-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | PYOCIHHXDXBLOU-CYBMUJFWSA-N |
| XLogP | 2.13 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |