C19H23FN2O3 — CID 97330047
(4aR,8aR)-1-cyclopropyl-6-(4-fluoro-3-methoxybenzoyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 97330047) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is (4aR,8aR)-1-cyclopropyl-6-(4-fluoro-3-methoxybenzoyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aR)-1-cyclopropyl-6-(4-fluoro-3-methoxybenzoyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 97330047 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (4aR,8aR)-1-cyclopropyl-6-(4-fluoro-3-methoxybenzoyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | COc1cc(C(=O)N2CC[C@@H]3[C@H](CCC(=O)N3C3CC3)C2)ccc1F |
| InChI | InChI=1S/C19H23FN2O3/c1-25-17-10-12(2-6-15(17)20)19(24)21-9-8-16-13(11-21)3-7-18(23)22(16)14-4-5-14/h2,6,10,13-14,16H,3-5,7-9,11H2,1H3/t13-,16-/m1/s1 |
| InChIKey | PIBMHWQJCOZMDH-CZUORRHYSA-N |
| XLogP | 2.45 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |