C17H22N4O3 — CID 166191338
4-(1-cyclopropyl-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl)-1H-pyrrole-2-carboxamide (PubChem CID 166191338) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 4-(1-cyclopropyl-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(1-cyclopropyl-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 166191338 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 4-(1-cyclopropyl-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl)-1H-pyrrole-2-carboxamide |
| SMILES | NC(=O)c1cc(C(=O)N2CCC3C(CCC(=O)N3C3CC3)C2)c[nH]1 |
| InChI | InChI=1S/C17H22N4O3/c18-16(23)13-7-11(8-19-13)17(24)20-6-5-14-10(9-20)1-4-15(22)21(14)12-2-3-12/h7-8,10,12,14,19H,1-6,9H2,(H2,18,23) |
| InChIKey | SMYIULXSILHAIB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |