C21H35N3O2 — CID 98794331
(4aR,8aR)-1-cyclopropyl-6-[(2S)-1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-oxopropan-2-yl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 98794331) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is (4aR,8aR)-1-cyclopropyl-6-[(2S)-1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-oxopropan-2-yl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aR)-1-cyclopropyl-6-[(2S)-1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-oxopropan-2-yl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 98794331 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | (4aR,8aR)-1-cyclopropyl-6-[(2S)-1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-oxopropan-2-yl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=O)[C@H](C)N2CC[C@@H]3[C@H](CCC(=O)N3C3CC3)C2)C1 |
| InChI | InChI=1S/C21H35N3O2/c1-14-10-15(2)12-23(11-14)21(26)16(3)22-9-8-19-17(13-22)4-7-20(25)24(19)18-5-6-18/h14-19H,4-13H2,1-3H3/t14-,15+,16-,17+,19+/m0/s1 |
| InChIKey | RVUDBEBEBYSRMS-HTBDUDNFSA-N |
| XLogP | 2.35 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |