C20H21N3O2S — CID 97332491
1-[2-(1,3-benzothiazol-2-yl)phenyl]-3-[(2R,4S)-2-methyloxan-4-yl]urea (PubChem CID 97332491) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-[2-(1,3-benzothiazol-2-yl)phenyl]-3-[(2R,4S)-2-methyloxan-4-yl]urea.
| Compound Name | 1-[2-(1,3-benzothiazol-2-yl)phenyl]-3-[(2R,4S)-2-methyloxan-4-yl]urea |
|---|---|
| PubChem CID | 97332491 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1-[2-(1,3-benzothiazol-2-yl)phenyl]-3-[(2R,4S)-2-methyloxan-4-yl]urea |
| SMILES | C[C@@H]1C[C@@H](NC(=O)Nc2ccccc2-c2nc3ccccc3s2)CCO1 |
| InChI | InChI=1S/C20H21N3O2S/c1-13-12-14(10-11-25-13)21-20(24)23-16-7-3-2-6-15(16)19-22-17-8-4-5-9-18(17)26-19/h2-9,13-14H,10-12H2,1H3,(H2,21,23,24)/t13-,14+/m1/s1 |
| InChIKey | HQZVANUHPBBJQV-KGLIPLIRSA-N |
| XLogP | 4.65 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |