C17H27NO3S — CID 97334058
trans-(1R,2R)-N-[(4-ethoxy-3-methylphenyl)methyl]-2-methylsulfonylcyclohexan-1-amine (PubChem CID 97334058) has the molecular formula C17H27NO3S and a molecular weight of 325.47 g/mol. Its IUPAC name is trans-(1R,2R)-N-[(4-ethoxy-3-methylphenyl)methyl]-2-methylsulfonylcyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-N-[(4-ethoxy-3-methylphenyl)methyl]-2-methylsulfonylcyclohexan-1-amine |
|---|---|
| PubChem CID | 97334058 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | trans-(1R,2R)-N-[(4-ethoxy-3-methylphenyl)methyl]-2-methylsulfonylcyclohexan-1-amine |
| SMILES | CCOc1ccc(CN[C@@H]2CCCC[C@H]2S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C17H27NO3S/c1-4-21-16-10-9-14(11-13(16)2)12-18-15-7-5-6-8-17(15)22(3,19)20/h9-11,15,17-18H,4-8,12H2,1-3H3/t15-,17-/m1/s1 |
| InChIKey | FFKAWIJXYVVERN-NVXWUHKLSA-N |
| XLogP | 2.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|