C15H20N2O4 — CID 97334636
ethyl (3S)-3-[[2-(3-methylanilino)-2-oxoacetyl]amino]butanoate (PubChem CID 97334636) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is ethyl (3S)-3-[[2-(3-methylanilino)-2-oxoacetyl]amino]butanoate.
| Compound Name | ethyl (3S)-3-[[2-(3-methylanilino)-2-oxoacetyl]amino]butanoate |
|---|---|
| PubChem CID | 97334636 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethyl (3S)-3-[[2-(3-methylanilino)-2-oxoacetyl]amino]butanoate |
| SMILES | CCOC(=O)C[C@H](C)NC(=O)C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C15H20N2O4/c1-4-21-13(18)9-11(3)16-14(19)15(20)17-12-7-5-6-10(2)8-12/h5-8,11H,4,9H2,1-3H3,(H,16,19)(H,17,20)/t11-/m0/s1 |
| InChIKey | GKMBESAOZUUIFN-NSHDSACASA-N |
| XLogP | 1.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|