C15H24N2OS2 — CID 97336213
(1S,6R,7R)-8,8-dimethyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]-2-oxabicyclo[4.2.0]octan-7-amine (PubChem CID 97336213) has the molecular formula C15H24N2OS2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (1S,6R,7R)-8,8-dimethyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]-2-oxabicyclo[4.2.0]octan-7-amine.
| Compound Name | (1S,6R,7R)-8,8-dimethyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]-2-oxabicyclo[4.2.0]octan-7-amine |
|---|---|
| PubChem CID | 97336213 |
| Molecular Formula | C15H24N2OS2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (1S,6R,7R)-8,8-dimethyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]-2-oxabicyclo[4.2.0]octan-7-amine |
| SMILES | CC1(C)[C@H](NCCCSc2nccs2)[C@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C15H24N2OS2/c1-15(2)12(11-5-3-8-18-13(11)15)16-6-4-9-19-14-17-7-10-20-14/h7,10-13,16H,3-6,8-9H2,1-2H3/t11-,12-,13+/m1/s1 |
| InChIKey | VSZQJSXMWMNDNE-UPJWGTAASA-N |
| XLogP | 3.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|