C17H28N4O — CID 97336283
(8R)-N-[(1S,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 97336283) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is (8R)-N-[(1S,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | (8R)-N-[(1S,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 97336283 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | (8R)-N-[(1S,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | CCO[C@@H]1C[C@H](N[C@@H]2CCCn3ncnc32)C12CCCCC2 |
| InChI | InChI=1S/C17H28N4O/c1-2-22-15-11-14(17(15)8-4-3-5-9-17)20-13-7-6-10-21-16(13)18-12-19-21/h12-15,20H,2-11H2,1H3/t13-,14+,15-/m1/s1 |
| InChIKey | FHHMGRHULPJISS-QLFBSQMISA-N |
| XLogP | 2.83 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |